This compound is a protected proline derivative used as an intermediate in peptide synthesis. Its structure features a tert-butoxycarbonyl (Boc) protecting group on the nitrogen and a free carboxylic acid, making it valuable for solid-phase and solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 26250-84-0
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
Boc-L-proline
Protected amino acid for peptide synthesis
(S)-(-)-1-Phenylethylamine
Chiral resolution intermediate
3-Iodooxetane
pharmaceutical intermediate
(2S)-1-amino-1-oxo-3-((3S)-2-oxopyrrolidin-3-yl)propan-2-aminium chloride
pharmaceutical intermediate
2-Amino-2,3-dimethylbutanoic acid
Pharmaceutical intermediate for amino acid derivatives
(2R)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
JQAOHGMPAAWWQO-QMMMGPOBSA-N
CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)O