Phenoxathiin is a sulfur- and oxygen-containing heterocyclic compound with a molecular weight of approximately 200 g/mol. It is primarily employed as a research compound for the study of organic phosphorescence.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 262-20-4
(4-methoxyphenyl)(2-methyl-1h-indol-3-yl)methanone
research compound
Methyl 6-bromopyridine-2-carboxylate
research chemical
Methyl 6-methoxypyridine-3-carboxylate
Research compound for nicotinic receptor studies
Allylmagnesium chloride
Grignard reagent for introducing allyl group
phenoxathiine
GJSGGHOYGKMUPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)OC3=CC=CC=C3S2