This compound is an azo compound used as a polymerization initiator in industrial chemical processes. It features two ester and two ether functional groups, contributing to its role in initiating free-radical polymerizations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2589-57-3
Tert-butyl 2-ethylhexaneperoxoate
polymerization initiator
Tert-Butyl peroxypivalate
polymerization initiator
Peroxydicarbonic acid, bis(2-ethylhexyl) ester
polymerization initiator
1,1-Bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane
polymerization initiator
2-Pentenenitrile, (Z)-
chemical intermediate
2-(2H-Benzotriazol-2-yl)-4,6-ditertpentylphenol
UV absorber for plastics
Gamma-Glycidoxypropyltriethoxysilane
silane coupling agent
Hydrochloric acid
acid cleaning and metal processing
methyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoate
ZQMHJBXHRFJKOT-UHFFFAOYSA-N
CC(C)(C(=O)OC)N=NC(C)(C)C(=O)OC