3-(Trimethoxysilyl)propyl methacrylate is a silane coupling agent commonly used to improve adhesion between organic polymers and inorganic substrates. Its molecular structure combines a methacrylate group for polymer bonding with trimethoxysilyl groups for surface attachment, making it valuable in adhesive formulations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2530-85-0
3-Chloropropyltrimethoxysilane
Coupling agent for filled composites
Sodium O-isobutyl dithiocarbonate
flotation collector agent
Benzyltributylammonium bromide
Phase transfer catalyst
Polietilen glikol
polymer and surfactant raw material
3-trimethoxysilylpropyl 2-methylprop-2-enoate
XDLMVUHYZWKMMD-UHFFFAOYSA-N
CC(=C)C(=O)OCCC[Si](OC)(OC)OC