This compound is a hydrochloride salt of S-tert-butyl-L-cysteine, a derivative of the amino acid cysteine. It is primarily used as a research reagent in laboratory settings, particularly in studies involving modified amino acids for peptide synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2481-09-6
Trimethyl orthopropionate
chemical reagent and intermediate
FMOC-PRO-THR(PSI(ME,ME)PRO)-OH
research compound for peptide synthesis
(2S)-2,6-Bis({[(Tert-Butoxy)Carbonyl]Amino})Hexanoic Acid
protected lysine derivative for peptide synthesis
D-Allothreonine
D-alpha-amino acid standard
(2R)-2-amino-3-tert-butylsulfanylpropanoic acid;hydrochloride
MHBMYFJKEBCMDR-JEDNCBNOSA-N
CC(C)(C)SC[C@@H](C(=O)O)N.Cl