9H-Pyrido[2,3-b]indole is a research compound classified by the International Agency for Research on Cancer (IARC) as possibly carcinogenic to humans (Group 2B), based on limited evidence in humans and sufficient evidence in experimental animals. It is a tricyclic heterocyclic compound used primarily as a laboratory reagent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 244-76-8
(2-bromophenyl)boronic Acid
research reagent for organic synthesis
5-Chloro-2-iodopyridine
research compound
Di-tert-butyl dicarbonate
Reagent for amine Boc protection
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(diphenylphosphine)
chiral ligand for asymmetric catalysis
9H-pyrido[2,3-b]indole
BPMFPOGUJAAYHL-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)N=CC=C3