This compound is a glutamic acid derivative featuring a tert-butyl ester protecting group on the side chain carboxyl. It is primarily used as a research reagent in peptide synthesis and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2419-56-9
Di-tert-butyl Glutamate Hydrochloride
Pharmaceutical intermediate for peptide synthesis
TERT-BUTYL (4S)-4-AMINO-4-CARBAMOYLBUTANOATE HYDROCHLORIDE
Peptide synthesis intermediate
Methyl 4-acetamido-5-chloro-2-hydroxybenzoate
pharmaceutical intermediate
(10E,12Z)-10,12-Octadecadienoic acid
analytical reference standard for CLA research
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
OIOAKXPMBIZAHL-LURJTMIESA-N
CC(C)(C)OC(=O)CC[C@@H](C(=O)O)N