2-Bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone is a brominated difluorophenoxyphenyl ketone compound used primarily as a chemical intermediate in organic synthesis. Its structure features two aromatic rings, an ether linkage, and a halogenated ketone moiety, making it suitable for constructing more complex molecules in research and laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2410975-52-7
N-Biotinyl Dopamine
research compound for biotinylation studies
9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-3,6-bis(9-phenylcarbazol-3-yl)carbazole
organic semiconductor research compound
AST5902 mesylate
research compound for tyrosine kinase
Acalabrutinib Impurity 21
pharmaceutical impurity reference standard
2-bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone
GEBMDWUJIRFTKK-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)C(=O)CBr)F
—