t-boc-N-amido-PEG11-azide is a polyethylene glycol (PEG)-based research reagent featuring a tert-butyl carbamate (Boc) protected amine at one end and an azide group at the other. Its long, flexible PEG chain provides high solubility in aqueous media and low immunogenicity, making it valuable as a coupling reagent in bioconjugation chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2395004-21-2
Methyl 6-(pentafluoro-l6-sulfanyl)nicotinate
research compound
3-Bromoanisole
Research reagent
1-(1-Methyl-4-piperidinyl)piperazine
research compound
2,3,6-TRIBROMOPYRIDINE
research compound
tert-butyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate
JGWSHTKKDWKMAY-UHFFFAOYSA-N
CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]