2-Phenyl-9H-carbazole-d5 is a deuterated derivative of 2-phenyl-9H-carbazole, where the hydrogen atoms on the phenyl ring are replaced with deuterium. It is primarily used as an isotopic internal standard or reference standard in analytical research, particularly in mass spectrometry and chromatography.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2375066-12-7
4-Hydroxybenzaldehyde-2,3,5,6-d4
deuterated reference standard for research
(2H5)Glycine
deuterated reference standard for research
Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-oxoacetate
research compound
4-(Chlorodifluoromethyl)-2-fluoropyridine
research compound
Azido-PEG24-NHS ester
PEGylated bioconjugation reagent
(S)-1-Benzyl-3,3-difluoropiperidin-4-ol
research compound
2-(2,3,4,5,6-pentadeuteriophenyl)-9H-carbazole
IMLDYQBWZHPGJA-FSTBWYLISA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC3=C(C=C2)C4=CC=CC=C4N3)[2H])[2H]