This compound is a deuterated reference standard, specifically a brominated biphenyl derivative where all nine hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and research as an internal standard or tracer for mass spectrometry and other quantitative methods.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2363789-28-8
1-(2-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
Deuterated reference standard
4-Bromotoluene (Methyl D3)
Deuterated reference standard
1,2,4-TRIAZOLE-D3
Deuterated reference standard
[3-(trideuteriomethyl)phenyl]methanol
Deuterated reference standard
Dichloro(dimethylglyoxime)(dimethylglyoximato)cobalt(III)
vitamin B12 model research compound
1H-Purine-6-carboxylic acid
research compound
Propanoic acid, 2-fluoro-, methyl ester
Research reagent for organic synthesis
Phenylzinc iodide
cross-coupling reagent
1-bromo-2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)benzene
USYQKCQEVBFJRP-LOIXRAQWSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])Br)[2H])[2H])[2H]