This compound is an industrial chemical primarily used as a processing aid in manufacturing operations. It features a complex aromatic structure with sulfonamide and carbamate functional groups, contributing to its role in industrial applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 232938-43-1
2-Propanol, 1,3-bis((3-methyl-2-buten-1-yl)oxy)-
intermediate for chemical synthesis
Methyl 2-bromo-2-methylpropanoate
Chemical intermediate for synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
2-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazine
Electronic material intermediate
[3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate
HEVGMYPGMWZOBU-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)C