Nicotinamide riboside chloride is a N-glycosyl compound used in research as a precursor for NAD+ modulation. Its structure features a ribose sugar linked to a nicotinamide moiety, and it is commonly investigated for its role in cellular metabolism studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 23111-00-4
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide;(3R)-3,4-dihydroxy-4-oxobutanoate
n.a
Nicotinamide Riboside Triflate
Research compound for NAD+ metabolism
Nicotinamide riboside
vitamin B3 precursor
D-ribosylnicotinate
human metabolite and nicotinate riboside
(2,6-dimethoxyphenyl)boronic acid
Organic synthesis building block
1-(3-hydroxypyrrolidin-1-yl)ethanone
Research compound
Dimethyl L-Glutamate Hydrochloride
research compound
3',4'-dimethoxycinnamic acid
research compound
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide chloride
YABIFCKURFRPPO-IVOJBTPCSA-N
C1=CC(=C[N+](=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N.[Cl-]