2-Bromo-5-methoxybenzoic acid is a brominated aromatic carboxylic acid used as a pharmaceutical intermediate. Its structure features a benzoic acid core with a bromine atom at the 2-position and a methoxy group at the 5-position, making it a versatile building block for organic synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 22921-68-2
2-bromo-4-methoxybenzoic acid
research compound
4-Tritylaniline
Pharmaceutical intermediate for synthesis
2,4-THIAZOLIDINEDIONE
Pharmaceutical intermediate and research compound
(3aR,4R,6S,6aS)-Methyl 4-((tert-butoxycarbonyl)amino)-3-(pentan-3-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]isoxazole-6-carboxylate
Pharmaceutical intermediate for Peramivir
(1S,4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-2-en-1-ol
Lisdexamfetamine intermediate
2-bromo-5-methoxybenzoic acid
ODHJOROUCITYNF-UHFFFAOYSA-N
COC1=CC(=C(C=C1)Br)C(=O)O