This compound is a deuterated form of 1,4-benzoquinone, where all four hydrogen atoms on the ring are replaced with deuterium. It is primarily used as a research reagent in scientific studies requiring isotopic labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2237-14-1
Mometasone Furoate EP Impurity B
Analytical reference standard impurity
(2S)-N-[(2S)-1-[4-[(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl]anilino]-1-oxopropan-2-yl]-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide
antibody-drug conjugate linker payload
2-Chloro(phenyl-3,4,5,6-d4)-boronic acid
deuterated chemical research reagent
2,2'-Anhydro-athy
UPase inhibitor research compound
P-benzoquinone
chemical intermediate and oxidizing agent
Koenzim Q10
active pharmaceutical ingredient
Idebenone
Active pharmaceutical ingredient
Trimethylquinone
Quinone intermediate for synthesis
2,3,5,6-tetradeuteriocyclohexa-2,5-diene-1,4-dione
AZQWKYJCGOJGHM-RHQRLBAQSA-N
[2H]C1=C(C(=O)C(=C(C1=O)[2H])[2H])[2H]