Naproksen
(S)-Naproxen is the single-enantiomer active pharmaceutical ingredient of the common nonsteroidal anti-inflammatory drug naproxen. Its structure features a carboxylic acid group, an aromatic ring system, and an ether moiety, with a molecular weight of 230.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 22204-53-1
(3R,6E)-7-(2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl)-3-hydroxy-5-oxo-6-heptenoic acid
statin metabolite impurity
Carbimazole
antithyroid agent
(E)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-hydroxyquinazolin-6-yl)-4-(dimethylamino)but-2-enamide
active pharmaceutical ingredient
(S,E)-N-(4-((3,4-Difluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)-4-(dimethylamino)but-2-enamide (Afatinib Impurity)
Afatinib impurity reference standard
2-(6-Methoxy-2-naphthyl)propionic acid
active pharmaceutical ingredient
Naproxen sodium
non-steroidal anti-inflammatory drug
Rac Naproxen-d3
Deuterated active pharmaceutical ingredient
(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid
CMWTZPSULFXXJA-VIFPVBQESA-N
C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O