2-Hydroxyestradiol-d5 is a deuterium-labeled research compound, structurally related to the endogenous estrogen 2-hydroxyestradiol, used primarily in analytical and biochemical studies for tracing metabolic pathways.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 221093-33-0
2-Methoxy-17beta-estradiol-1,4,16,16,17-d5
research reagent
(8R,9S,13S,14S,17S)-16,16,17-Trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,4,17-triol
deuterated internal standard
2-{[(4-fluorophenyl)methyl]amino}ethan-1-ol
Research compound
5H-Pyrazolo[4,3-c]pyridine-5-carboxylic acid, 3-amino-2-(4-fluoro-3,5-dimethylphenyl)-2,4,6,7-tetrahydro-4-methyl-, 1,1-dimethylethyl ester, (4S)
research compound
(S)-5-(2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-YL)-N-METHYL-N-PHENYL-1H-INDOLE-2-CARBOXAMIDE
research compound
(8R,9S,13S,14S,17S)-1,4,16,16,17-pentadeuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3,17-triol
DILDHNKDVHLEQB-MLEVBVPTSA-N
[2H]C1=C2CC[C@@H]3[C@@H](C2=C(C(=C1O)O)[2H])CC[C@]4([C@H]3CC([C@]4([2H])O)([2H])[2H])C