Dimethyl sulfoxide-d6 is a deuterated form of dimethyl sulfoxide (DMSO), an organosulfur compound widely used as a polar aprotic solvent. Its primary significance lies in its role as a deuterated solvent for NMR spectroscopy, enabling clear analysis of organic compounds without solvent signal interference.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2206-27-1
Methyl Alcohol-d4
deuterated solvent for NMR spectroscopy
2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid succinimidyl ester
PEG-based crosslinking reagent
2-(2-bromophenyl)naphthalene
research chemical
Naphthalene, 2-(4-chlorophenyl)-
research compound
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
research compound
Dimethyl sulfoxide
Industrial solvent and reaction medium
trideuterio(trideuteriomethylsulfinyl)methane
IAZDPXIOMUYVGZ-WFGJKAKNSA-N
[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]