This compound is a research chemical consisting of a bis-triazole structure with diaryl ketone substituents. It is primarily used as a laboratory reagent for chemical and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2203515-05-1
(5-Chloro-2-(3-(chloromethyl)-5-methyl-4H-1,2,4-triazol-4-yl)phenyl)(phenyl)methanone
reference standard impurity
HB-Compound
alprazolam metabolite
(2-(3-(Aminomethyl)-5-methyl-4H-1,2,4-triazol-4-yl)-5-chlorophenyl)(phenyl)methanone
pharmaceutical intermediate
2,2-Bis(3-(3-aminobenZoylamino)-4-hydroxyphenyl)hexafluoropropane
research compound
1-Aminocyclopropanecarboxylic acid
biochemical research compound
(E)-N'-hydroxyacetimidamide
research compound
(2H3)Acetonitrile
NMR solvent
[2-[3-[[[4-(2-benzoyl-4-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]methylamino]methyl]-5-methyl-1,2,4-triazol-4-yl]-5-chlorophenyl]-phenylmethanone
YRRVKIRCJAMXRC-UHFFFAOYSA-N
CC1=NN=C(N1C2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C3)CNCC4=NN=C(N4C5=C(C=C(C=C5)Cl)C(=O)C6=CC=CC=C6)C