Boc-L-Nitroarginine is a protected derivative of the amino acid arginine, commonly employed in solid-phase peptide synthesis. Its structure features a tert-butyloxycarbonyl (Boc) protecting group on the alpha-amino group and a nitro-guanidino moiety on the side chain, which facilitates selective incorporation of arginine residues during peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2188-18-3
L-Arginine, N2-[(phenylmethoxy)carbonyl]-, monohydrochloride
protected arginine derivative for peptide synthesis
4-methoxy-2-methylbenzonitrile
Research compound
(Methylenebis(oxy))bis(ethane-2,1-diyl) diacetate
research compound
Ac-YVAD-AFC
fluorogenic caspase substrate
4-Fmoc-piperazine-2-carboxylic acid
Research reagent for peptide synthesis
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
OZSSOVRIEPAIMP-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N[N+](=O)[O-])C(=O)O