2-Bromo-5-chlorobenzoic acid is a chemical compound commonly employed as a pharmaceutical intermediate. It features a substituted benzoic acid structure with two halogen atoms, making it useful in the synthesis of active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 21739-93-5
Pregnenolone-16-ene acetate oxime
pharmaceutical intermediate for abiraterone
5-Bromo-2-iodobenzoic acid
Pharmaceutical intermediate
1-(Chloromethyl)-2-(trifluoromethyl)benzene
organic synthesis intermediate
Tert-butyl N-(azetidin-3-yl)carbamate hydrochloride
pharmaceutical intermediate for API synthesis
2-bromo-5-chlorobenzoic acid
RBCPJQQJBAQSOU-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Br