Phenyl-d5-boronic acid is a deuterated research reagent in which the five hydrogen atoms on the phenyl ring are replaced by deuterium. It is primarily used in synthetic chemistry as a labeled building block for the preparation of deuterated organic compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 215527-70-1
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(3S)-3-aminoazepan-2-one
research compound
4-Acetamidobenzenesulfonyl azide
sulfonyl azide reagent
3-Isopropylbenzeneboronic acid
chemical intermediate for synthesis
Phenylboronic acid
n.a
(2,3,4,5,6-pentadeuteriophenyl)boronic acid
HXITXNWTGFUOAU-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])B(O)O)[2H])[2H]