This compound is a PEG-based conjugation reagent featuring an N-hydroxysuccinimide (NHS) ester group and a protected amine functionality. It is commonly used in bioconjugation chemistry for the attachment of molecules to primary amines under mild conditions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2101206-31-7
Ald-Ph-amido-PEG2-C2-Pfp ester
research reagent for bioconjugation
((2,4-dimethylphenyl)diazenyl)(3-methoxyphenyl)methanone
research compound
5-fluoropyridin-3-amine
research compound
2,6-dibromo-3,5-difluoropyridine
Research reagent for organic synthesis
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]propanoate
UXABBPKGOKMLNT-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCON2C(=O)C3=CC=CC=C3C2=O