This compound is a research reagent with a complex polycyclic structure, featuring a benzo[de]isoquinoline-1,3-dione core substituted with a hydroxypropyl group and a trimethylbenzimidazolone moiety. It is primarily used as a research compound for biological studies, as indicated by its availability from chemical suppliers.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2080306-23-4
2(1H)-Quinolinone, 7-(4-(4-(1,1-dioxidobenzo(b)thien-4-yl)-1-piperazinyl)butoxy)-
Research compound for biological studies
[Rh COD (R)-Binap]BF4
chiral hydrogenation catalyst
5-Bromonicotinic acid
research compound
N-(Furan-2-Ylmethyl)-8-(4-Methylsulfonylphenyl)-[1,2,4]triazolo[4,3-C]pyrimidin-5-Amine
Polycomb repressive complex 2 inhibitor
3-Oxo-3,4-dihydro-2h-pyrazino[2,3-b][1,4]thiazine-6-carbaldehyde
research compound
6-(3-hydroxypropyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione
OFWWWKWUCDUISA-UHFFFAOYSA-N
CC1=CC2=C(C=C1N3C(=O)C4=C5C(=C(C=C4)CCCO)C=CC=C5C3=O)N(C(=O)N2C)C