This compound is a spirobifluorene derivative with multiple triarylamine and methoxy substituents, characterized by a high molecular weight and 14 ring systems. It is primarily used as a hole transport material in solar cell research due to its aromatic, amine-containing structure.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 207739-72-8
Manganese(II) Bis(trifluoromethanesulfonyl)imide
lithium-ion battery electrolyte additive
Benzene, 5-[difluoro[(trans,trans)-4'-propyl[1,1'-bicyclohexyl]-4-yl]methoxy]-1,2,3-trifluoro-
liquid crystal intermediate
N-(4-(Naphthalen-2-yl)phenyl)naphthalen-2-amine
electronic material
4-(naphthalen-2-yl)aniline
OLED intermediate chemical
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
XDXWNHPWWKGTKO-UHFFFAOYSA-N
COC1=CC=C(C=C1)N(C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)C5=C(C46C7=C(C=CC(=C7)N(C8=CC=C(C=C8)OC)C9=CC=C(C=C9)OC)C1=C6C=C(C=C1)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC)C=C(C=C5)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC