This compound is a deuterated form of 1-naphthol, where all hydrogen atoms on the naphthalene ring and the hydroxyl group are replaced with deuterium. It is primarily used as a research reference standard in analytical chemistry and stable isotope labeling studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 207569-03-7
1-Phenylethanol-d10
deuterated research reference standard
(O,1,1,1,2,3,3,3-2H8)Propan-2-ol
deuterated research reference standard
Benzene-1,2-d2, 3,4,5,6-tetrachloro-
deuterated research reference standard
1-OCTANE-D17-THIOL
deuterated research reference standard
Sodium taurodeoxycholate hydrate
biochemical research reagent
3,3',5,5'-Tetramethyl(1,1'-biphenyl)-4,4'-diamine--hydrogen chloride--water (1/2/1)
research reagent for peroxidase assays
2,5-dimethoxy-4-ethylthiophenethylamine
psychedelic research compound
3,3'-DIBROMO-5,5'-BIS(TRIMETHYLSILYL)-2,2'-BITHIOPHENE
Organic synthesis building block
1,2,3,4,5,6,7-heptadeuterio-8-deuteriooxynaphthalene
KJCVRFUGPWSIIH-GZORGGLCSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O[2H])[2H])[2H])[2H])[2H])[2H]