This compound is a research reagent featuring a dioxane ring with multiple ester functional groups. It is primarily used as a chemical intermediate for laboratory-scale synthesis and investigation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2070015-38-0
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
D-4-Methoxymandelic acid
research compound
3-Ethynylaniline hydrochloride
research chemical
Saikosaponin-C
phytochemical reference standard
Mesityl-d10 oxide
isotopically labeled research compound
Ethyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
2,2,5-Trimethyl-1,3-dioxane-4,6-dione
Pharmaceutical intermediate
1,3-Dioxane-5-propanoic acid, 2,2-dimethyl-4,6-dioxo-, methyl ester
n.a
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate
VBRYYLKXUUYJJE-UHFFFAOYSA-N
CCOC(=O)CCC1(C(=O)OC(OC1=O)(C)C)CCC(=O)OCC
—