This compound is a peptide-like molecule featuring a pyrrolidine ring and a cyclohexyl group, with multiple functional groups including an acid, amide, amine, ester, and ether. It is primarily used as a research compound in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2055735-10-7
8-Bromo-1-chlorodibenzo[b,d]thiophene
Research reagent for synthetic chemistry
MC-Val-Cit-PAB-Auristatin E
antibody-drug conjugate linker payload
MC-Val-Cit-PAB-duocarmycin
antibody drug conjugate linker payload
DCTP
nucleotide triphosphate for DNA synthesis
Lisinopril specified impurity F
pharmaceutical impurity reference standard
(2S)-1-[(2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid
ZARBDUSKHGGCSR-XIRDDKMYSA-N
CCOC(=O)[C@H](CCC1CCCCC1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O