3-Acetylphenylboronic acid is an organic compound featuring a boronic acid group and an acetyl substituent on a phenyl ring. It is commonly employed as a research reagent, particularly in synthetic chemistry for the formation of carbon-carbon bonds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 204841-19-0
4-Acetylphenylboronic acid
Boronic acid research reagent
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
4-Mercaptophenylboronic acid
Boronic acid research reagent
2-Naphthylboronic acid
Boronic acid research reagent
DI-I-PROPYLPHOSPHINE
organophosphorus research reagent
(R)-[(RUCL(H8-BINAP))2(MU-CL)3][NH2ME2]
asymmetric hydrogenation catalyst
Benzo[b]naphtho[1,2-d]furan
diene for Diels-Alder reaction
Cycloocta-1,5-diene;(2S,5S)-1-[2-[(2S,5S)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;rhodium;tetrafluoroborate
chiral rhodium complex for asymmetric catalysis
(3-acetylphenyl)boronic acid
SJGGDZCTGBKBCK-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(=O)C)(O)O