This compound is a fluorinated pyrrolidine derivative with a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid moiety. It is a research compound used in laboratory and manufacturing settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 203866-13-1
3-Methoxyphenethylamine
Research compound
Methyl 3-phenanthryl ketone
research compound
4-BROMOSTYRENE
research compound for synthesis
5-Chloropentyl acetate
chemical intermediate
(2S,4R)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4S)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4R)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
YGWZXQOYEBWUTH-BQBZGAKWSA-N
CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)F