This compound is a photoaffinity labeling reagent featuring two azide groups attached to aromatic rings, which can be activated by light to form covalent bonds with target biomolecules. It is primarily used in research to study molecular interactions and identify binding sites on proteins.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 20237-98-3
2-BROMOBUTANE-D9
Deuterated research compound
3,4-Dimethoxybenzonitrile
research compound
(+/-)-1,2-Propylene-d6 Oxide
Deuterated reference standard for NMR
Chloramphenicol D5
Deuterated analytical reference standard
(2E,6E)-2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one
UZNOMHUYXSAUPB-UNZYHPAISA-N
C1C/C(=C\C2=CC=C(C=C2)N=[N+]=[N-])/C(=O)/C(=C/C3=CC=C(C=C3)N=[N+]=[N-])/C1
—