N-Benzyloxycarbonyl-L-leucine is a chemical compound used as a protecting group reagent in peptide synthesis. It is also the substrate for the enzyme Nα-benzyloxycarbonylleucine hydrolase, which catalyzes its hydrolysis to benzyl alcohol, carbon dioxide, and L-leucine.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2018-66-8
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
6-BROMO-1-BENZOFURAN-3(2H)-ONE
Pharmaceutical intermediate
(3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one
synthetic intermediate for beta-lactam antibiotics
(2R,3R)-N-((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)-3-Methoxy-2-Methyl-3-((S)-pyrrolidin-2-yl)propanaMide (hydrochloride)
peptide intermediate for pharmaceutical research
2-(3-chloro-5-fluorophenyl)acetic acid
Pharmaceutical intermediate for drug synthesis
(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid
USPFMEKVPDBMCG-LBPRGKRZSA-N
CC(C)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1