Fmoc-Pen(Trt)-OH is a synthetic building block used in peptide chemistry. It is a protected derivative of penicillamine, featuring an Fmoc group for temporary amino protection and a trityl (Trt) group for side-chain thiol protection, making it suitable for solid-phase peptide synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 201531-88-6
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanine
Peptide synthesis building block
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)triphenyl-L-methionine
Peptide synthesis building block
N-alpha-(9-Fluorenylmethyloxycarbonyl)-N-beta-trityl-D-asparagine
Peptide synthesis building block
N-Fmoc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Peptide synthesis building block
Diethyl dichloromalonate
pharmaceutical intermediate
N-Acetyl-S-(2-carboxyethyl)-L-cysteine Bis(dicyclohexylamine) Salt
N-acetylcysteine impurity reference standard
(R)-N-[5-(2-Bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]formamide
Pharmaceutical intermediate
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid
XSGMGAINOILNJR-PGUFJCEWSA-N
CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6