1,4-Benzenedicarboxylic acid, bis(phenylmethyl) ester, also known as This compound, is an industrial chemical primarily used as a plasticizer intermediate for polymers. It features a structure with two ester groups and aromatic rings, contributing to its role in polymer manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 19851-61-7
Benzil benzoat
scabicide and insect repellent
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
4-HEPTYLPHENOL
Alkylphenol intermediate for industrial synthesis
2,6-Diisopropyl-1,4-benzoquinone
benzoquinone derivative for chemical synthesis
N,N,N-trimethylcyclohexanaminium hydroxide
phase transfer catalyst
2-CHLORO-4-FLUOROPHENOL
chemical intermediate for synthesis
dibenzyl benzene-1,4-dicarboxylate
IWGFEQWCMAADJZ-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)C(=O)OCC3=CC=CC=C3