N-Boc-1,4-cyclohexanediamine is a pharmaceutical intermediate compound featuring a tert-butyl carbamate protecting group attached to a cyclohexanediamine backbone, with one amino group free and the other protected. It is primarily used in the synthesis of more complex molecules, serving as a building block in pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 195314-59-1
N-Boc-1,4-cyclohexanediamine
pharmaceutical intermediate
N-Boc-1,4-cyclohexanediamine
Pharmaceutical intermediate for synthesis
Tert-butyl n-[(1s,3s)-3-aminocyclopentyl]carbamate
pharmaceutical intermediate
2-Cyanoethyl (((2S,3S,5R)-5-(2-isobutyramido-6-oxo-3,6-dihydro-9H-purin-9-yl)-3-(tritylamino)tetrahydrofuran-2-yl)methyl) diisopropylphosphoramidite
nucleoside phosphoramidite monomer for oligonucleotide synthesis
3 -TRNH-DT-5 -CEPA
oligonucleotide synthesis phosphoramidite building block
Triphenylvalsartan
pharmaceutical intermediate
2-(hydroxymethyl)-1H-1,3-benzodiazole-4-carboxylic acid hydrochloride
pharmaceutical intermediate
tert-butyl N-(4-aminocyclohexyl)carbamate
FEYLUKDSKVSMSZ-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1CCC(CC1)N