Lawesson's reagent is a organophosphorus compound containing a four-membered dithiadiphosphetane ring with two methoxyphenyl substituents and two sulfur atoms bonded to phosphorus. It is primarily used as a thionating agent to convert carbonyl groups into thiocarbonyl groups in organic synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 19172-47-5
2-Thiopheneacetic acid
research compound
2-methylthiophene-3-carboxylic acid
research compound
Aristeromycin
nucleoside analogue research compound
HIV-1 Tat Protein (47-57)
research reagent
2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetane
CFHGBZLNZZVTAY-UHFFFAOYSA-N
COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC