Diphenylacetyl chloride is a chemical compound used as an intermediate in organic synthesis. It features two aromatic rings and a reactive acyl chloride group, making it useful for introducing the diphenylacetyl moiety into target molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1871-76-7
Diethylenetriaminepentaacetic dianhydride
Chemical synthesis intermediate
7-Octenoic acid
Research reagent
4,4,5,5-tetramethyl-2-[2-(3-phenylphenyl)phenyl]-1,3,2-dioxaborolane
research reagent for organic synthesis
3-Bromo-4'-iodo-1,1'-biphenyl
Research compound
3-Bromo-3'-iodo-1,1'-biphenyl
research compound
2,2-diphenylacetyl chloride
MSYLETHDEIJMAF-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)Cl