Isoleucine methyl ester hydrochloride is a chemical compound used as a research reagent, typically in laboratory settings for synthetic and biochemical studies. It is the hydrochloride salt form of the methyl ester derivative of the amino acid isoleucine.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 18598-74-8
3-chlorophenylzinc iodide
organometallic reagent for cross-coupling
Fmoc-Ala-Pro-OH
research compound for peptide synthesis
Fmoc-Val-Ser(Psime,Mepro)-OH
building block for peptide synthesis
Fmoc-PNA-C(Bhoc)-OH
Peptide nucleic acid building block
methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride
GGTBEWGOPAFTTH-GEMLJDPKSA-N
CC[C@H](C)[C@@H](C(=O)OC)N.Cl