This compound is a research reagent featuring a Boc-protected piperidine core with a fluorenylmethyloxycarbonyl-based substituent and a carboxylic acid group. It is structurally designed to serve as a building block in multistep organic synthesis, where protecting groups are employed to achieve chemoselectivity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 183673-66-7
1-(9H-fluoren-9-ylmethoxycarbonyl)-4-(tert-butoxycarbonylamino)piperidine-4-carboxylate
protected amino acid building block
2-Methyl-6-nitropyridine
research compound
4-Methyl-2-nitropyridine
research compound
3-(Trifluoromethyl)phenyl isothiocyanate
research compound
5'-Adenylic acid, monohydrate
Purine ribonucleoside monophosphate research reagent
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid
BOFOACPQHWDRLH-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24