2,4,6-Trifluorophenylboronic acid is a boronic acid derivative used as a reagent in cross-coupling reactions. It is recognized for its tendency to undergo protodeboronation, a side reaction that can affect coupling efficiency.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 182482-25-3
2-(Trifluoromethoxy)phenyl isocyanate
research compound
Pentanimidamide Hydrochloride
Research compound
Vinylmagnesium bromide
Grignard reagent for organic synthesis
3-fluorobicyclo[1.1.1]pentan-1-amine hydrochloride
Research compound for medicinal chemistry
(2,4,6-trifluorophenyl)boronic acid
IPEIGKHHSZFAEW-UHFFFAOYSA-N
B(C1=C(C=C(C=C1F)F)F)(O)O
—