This compound is a boronic ester derivative of benzoic acid, commonly used as a pharmaceutical intermediate. Its structure features a dioxaborolane ring attached to a benzoic acid moiety, making it suitable for carbon-carbon bond formation in drug synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 180516-87-4
N-alpha-(9-Fluorenylmethyloxycarbonyl)-N-beta-trityl-D-asparagine
Peptide synthesis building block
1,1-Cyclopentanedicarboxylic acid, 3-oxo-, diethyl ester
pharmaceutical intermediate
METHYL N-CBZ-PIPERIDINE-2-CARBOXYLATE
Peptide synthesis protecting group intermediate
2,6-Difluorobenzoyl chloride
Pharmaceutical intermediate for synthesis
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
IYDKBQIEOBXLTP-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O
—