This compound is a deuterated research reagent, specifically a stable isotope-labeled analog of 3-diethylamino acetaminophen. It is primarily used as an analytical standard or internal standard in mass spectrometry and other quantitative analytical methods.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1794789-22-2
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride)
Deuterated research compound
2-BROMOBUTANE-D9
Deuterated research compound
1-Methylimidazole-d6
Deuterated research compound
Clenpenterol-d5 Hydrochloride
Deuterated analytical reference standard
Acetaminophen Dimer-d6
isotope-labeled research compound
2-Phenylbutyric Acid-d5 Methyl Ester
deuterated research standard
Aceclofenac-d4,13C2 (major)
Isotope-labeled analytical reference standard
N-[3-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-hydroxyphenyl]acetamide
BOUCRWJEKAGKKG-IZUSZFKNSA-N
[2H]C([2H])([2H])C([2H])([2H])N(CC1=C(C=CC(=C1)NC(=O)C)O)C([2H])([2H])C([2H])([2H])[2H]
—