5-Methoxy-2-nitro-4-(trifluoromethyl)benzene acetonitrile is a chemical compound with the structure of a nitrile-bearing aromatic ring, characterized by the presence of methoxy, nitro, and trifluoromethyl substituents. It is used primarily as a pharmaceutical intermediate in the synthesis of various medicinal compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 178896-77-0
2,4-Difluoro-3-methoxybenzoic acid
Pharmaceutical intermediate
L-Aspartic acid, bis(1,1-dimethylethyl) ester, hydrochloride
pharmaceutical intermediate for peptide synthesis
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride)
Pharmaceutical research intermediate
1-Chloro-4-methoxybutane
pharmaceutical intermediate
2-[5-methoxy-2-nitro-4-(trifluoromethyl)phenyl]acetonitrile
IANAREFPKLOIAF-UHFFFAOYSA-N
COC1=C(C=C(C(=C1)CC#N)[N+](=O)[O-])C(F)(F)F
—