1,3-dichloro-2-methoxy-5-nitrobenzene is a chemical compound with a single aromatic ring, two chlorine substituents, a methoxy group, and a nitro group. It is structurally related to the phenethylamine 2C-N, though the provided evidence does not confirm its primary use or specific applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 17742-69-7
1,3-dichloro-2-methoxy-5-nitrobenzene
GJYVJKPFYCKNEC-UHFFFAOYSA-N
COC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
—