This compound is a deuterated form of 2-chlorobutane used primarily as a research reagent. Its structure incorporates nine deuterium atoms, providing a stable isotopic label for analytical and laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 175540-77-9
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol
Research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine
Research reagent for chemical synthesis
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol--hydrogen chloride (1/1)
Research compound
2-CHLOROBUTANE
Organic synthesis intermediate
2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane
BSPCSKHALVHRSR-CBZKUFJVSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])Cl