This compound is a Fmoc-protected phospho-amino acid derivative of L-threonine, featuring a benzylphospho protective group on the hydroxyl side chain. It is primarily used as an intermediate in the solid-phase synthesis of phosphopeptides for research and pharmaceutical development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 175291-56-2
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(pyridin-3-yl)propanoic acid
Pharmaceutical intermediate for peptide synthesis
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
Tert-Butyl 3-cyano-4-oxo-pyrrolidine-1-carboxylate
pharmaceutical intermediate
1,3-Cyclohexanedione, 2-acetyl-5,5-dimethyl-
pharmaceutical intermediate for synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid
phosphorylated serine building block
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxybutanoic acid
HOFDVXHILSPFNS-OSPHWJPCSA-N
C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OP(=O)(O)OCC4=CC=CC=C4