This compound is a deuterated form of thiourea, where all four hydrogen atoms on the amino groups are replaced with deuterium. It is primarily used as a labeled research compound in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 17370-85-3
Benzene, (2-iodoethyl)-
research reagent
Benzyl glycinate
amino acid ester reagent
1,2-Dimethylimidazole
Research reagent and catalyst
Methyl (R)-lactate
enantiomerically pure methyl lactate
Thiocarbamide
Intermediate in chemical manufacturing
1,1,3,3-tetradeuteriothiourea
UMGDCJDMYOKAJW-JBISRTOLSA-N
[2H]N([2H])C(=S)N([2H])[2H]