This compound is a chiral amine used in research as a tool for studying serotonin receptor interactions. It features an aromatic ring substituted with two methoxy groups and a primary amine side chain, giving it specific structural properties relevant to neurochemical investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 17279-41-3
2-Amino-3-bromo-5-methylpyridine
research compound
3-Bromo-2-fluoro-5-methylpyridine
chemical synthesis intermediate
2-Chloro-3-fluoropyridine
Research compound
2-(3,4-dimethylphenyl)acetic acid
Research compound
3,4-Dimethoxyamphetamine, (R)-
research compound
(2S)-1-(3,4-dimethoxyphenyl)propan-2-amine
KAZPHAGSWZTKDW-QMMMGPOBSA-N
C[C@@H](CC1=CC(=C(C=C1)OC)OC)N