This compound is a morpholine-based pharmaceutical intermediate containing multiple fluorine atoms and a chiral center. It is primarily used in the synthesis of active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 171482-05-6
4-Methylbenzene-1-sulfonic acid--(2R,3S)-2-((1R)-1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine (1/1)
pharmaceutical intermediate
2-((1R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl) morpholine, (2R,3S)-
Nitrosamine impurity reference standard
2'-O-Propargyl g(iBu)-3'-phosphoramidite
phosphoramidite building block for oligonucleotide synthesis
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
Chloropretadalafil
pharmaceutical intermediate
8-Bromo-2'-benzamido-2'-deoxy-Adenosine
adenosine impurity reference standard
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride
DWCCMKXSGCKMJF-YNXGUESPSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F.Cl