Methyl 1H-indazole-6-carboxylate is a research compound featuring an indazole core with a methyl ester substituent. It is characterized by a fused ring system, aromaticity, and an ester functional group, making it a building block in chemical synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 170487-40-8
Methyl 1H-Indazole-5-carboxylate
research compound
Magnesium, bromooctyl-
Grignard reagent for organic synthesis
(r)-1-phenyl-3-propanolamine
research compound
H-Leu-Gln-Val-Gln-Leu-Ser-Ile-Arg-OH
Research peptide compound
1,2,5,6-di-O-Isopropylidene-D-mannitol
Research compound
methyl 1H-indazole-6-carboxylate
TUSICEWIXLMXEY-UHFFFAOYSA-N
COC(=O)C1=CC2=C(C=C1)C=NN2